Pigment yellow 65 – Corimax Yellow RN
Parameter teknikal Pigmen kuning 65
| Indeks Warna | Pigmen kuning 65 |
| Nama Produk | Corimax Kuning RN |
| Kategori Produk | Pigmen organik |
| Nombor CAS | 6528-34-3 |
| Nombor EU | 229-419-9 |
| Keluarga kimia | Monazo |
| Berat Molekul | 386.36 |
| Formula molekul | C18H18N4O6 |
| Nilai PH | 6.0-7.0 |
| Ketumpatan | 1.6 |
| Penyerapan Minyak (ml / 100g)% | 35-45 |
| Ketepatan cahaya (salutan) | 7 |
| Rintangan haba (salutan) | 140 |
| Rintangan Air | 5 |
| Rintangan Minyak | 3 |
| Rintangan Asid | 5 |
| Rintangan Alkali | 5 |
Warna | ![]() |
| Pengedaran Hue |
Ciri-ciri: Penyebaran yang baik.
Permohonan:
Disyorkan untuk lapisan seni bina, lapisan industri.
Maklumat Berkaitan
Pigment Yellow 65 is a high-performance, bright yellow pigment widely used in coatings, inks, plastics, and paints. It offers excellent lightfastness, weather resistance, and chemical stability, making it suitable for both indoor and outdoor applications. Known for its vibrant, clean yellow hue, it provides strong color strength and opacity, ensuring high-quality results. Pigment Yellow 65 is particularly popular in automotive coatings, printing inks, and industrial applications where durability and consistency are crucial. With its non-toxic and environmentally friendly properties, it is a reliable choice for manufacturers seeking long-lasting and vivid yellow colors.
Struktur molekul:
Formula molekul: C18H18N4O6
Berat Molekul: 386.36
Nombor Pendaftaran CAS: 6528-34-3
Kaedah Pembuatan: Diazotisasi 4-Metoksi-2-nitrobenzenamin, dan gandingan N- (2-metoksifenil) -3-oksobutanamida.
Sifat dan Aplikasi: kuning terang merah terang. Serbuk merah. Kelajuan cahaya matahari lebih baik. Rintangan terhadap Cellosole, minyak tanah, tidak mampu menanggung atau menahan xilena, alkali kalis asid dengan lebih baik. Dalam medium berminyak, terutama pada lapisan lateks yang digunakan, juga boleh digunakan untuk mewarnai lapisan, getah, budaya dan pendidikan.
Structural Identifiers
IUPAC Name: 2-[(4-Methoxy-2-nitrophenyl)diazenyl]-N-(2-methoxyphenyl)-3-oxobutanamide
SMILES: COC1=CC(=C(C=C1)N=NC(C(C)=O)C(=O)NC1=C(OC)C=CC=C1)[N+]([O-])=O
InChI String: InChI=1/C18H18N4O6/c1-11(23)17(18(24)19-14-6-4-5-7-16(14)28-3)21-20-13-9-8-12(27-2)10-15(13)22(25)26/h4-10,17H,1-3H3,(H,19,24)
InChIKey: UFORAEIAYCSGCR-UHFFFAOYSA-N
Synonyms
| 6528-34-3 |
| Permanent Yellow Rn |
| YELLOW65 |
| 2-[(4-methoxy-2-nitrophenyl)diazenyl]-N-(2-methoxyphenyl)-3-oxobutanamide |
| Butanamide,2-[(4-methoxy-2-nitrophenyl)azo]-N-(2-methoxyphenyl)-3-oxo- |
| Butanamide, 2-((4-methoxy-2-nitrophenyl)azo)-N-(2-methoxyphenyl)-3-oxo- |
| Butanamide, 2-[(4-methoxy-2-nitrophenyl)azo]-N-(2-methoxyphenyl)-3-oxo- |
| 2-[2-(4-METHOXY-2-NITROPHENYL)DIAZEN-1-YL]-N-(2-METHOXYPHENYL)-3-OXOBUTANAMIDE |
| EINECS 229-419-9 |
| EC 229-419-9 |
| SCHEMBL6928762 |
| 2-((4-Methoxy-2-nitrophenyl)azo)-o-acetoacetanisidide |
| DTXSID0052336 |
| SCHEMBL12760851 |
| UFORAEIAYCSGCR-UHFFFAOYSA-N |
| HY-D1204 |
| MFCD00071941 |
| AKOS037643608 |
| Butanamide, 2-(2-(4-methoxy-2-nitrophenyl)diazenyl)-N-(2-methoxyphenyl)-3-oxo- |
| AS-17500 |
| CS-0143082 |
| NS00003477 |
| EN300-207584 |
| 2-((4-Methoxy-2-nitrophenyl)azo)-N-(2-methoxyphenyl)-3-oxobutyramide |
| (E)-2-((4-methoxy-2-nitrophenyl)diazenyl)-N-(2-methoxyphenyl)-3-oxobutanamide |
Computed Properties
| Property Name | Property Value |
| Berat Molekul | 386.4 g/mol |
| XLogP3-AA | 3.3 |
| Hydrogen Bond Donor Count | 1 |
| Hydrogen Bond Acceptor Count | 8 |
| Rotatable Bond Count | 7 |
| Exact Mass | 386.12263431 Da |
| Monoisotopic Mass | 386.12263431 Da |
| Topological Polar Surface Area | 135 Ų |
| Heavy Atom Count | 28 |
| Formal Charge | 0 |
| Complexity | 593 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 1 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| Covalently-Bonded Unit Count | 1 |
| Compound Is Canonicalized | Yes |











